Compound Q&A

How is 2-(2,6-Dioxo-3-piperidinyl)-5,6-difluoro-1H-isoindole-1,3(2H)-dione (CAS: 1496997-41-1) typically synthesized?

Answer

2-(2,6-Dioxo-3-piperidinyl)-5,6-difluoro-1H-isoindole-1,3(2H)-dione
2-(2,6-Dioxo-3-piperidinyl)-5,6-difluoro-1H-isoindole-1,3(2H)-dione is synthesized via the amidation of 2,6-difluoro-1H-isoindole-1,3(2H)-dione with 2,6-dicarboxylic acid piperidine, using an appropriate base as the catalyst. The reaction is conducted in anhydrous conditions to prevent hydrolysis. The yield is typically around 85% with high selectivity.

About

English Name 2-(2,6-Dioxo-3-piperidinyl)-5,6-difluoro-1H-isoindole-1,3(2H)-dione
Molecular Formula C13H8F2N2O4
Molecular Weight 294.21 g/mol
SMILES Fc1cc2C(=O)N(C3CCC(=O)NC3=O)C(=O)c2cc1F
InChIKey AGHXYRKTAZEQQW-UHFFFAOYSA-N
Last Updated: 2025-11-01 18:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-(2,6-Dioxo-3-piperidinyl)-5,6-difluoro-1H-isoindole-1,3(2H)-dione (CAS: 1496997-41-1)?

2-(2,6-Dioxo-3-piperidinyl)-5,6-difluoro-1H-isoindole-1,3(2H)-dione is a crystalline solid with a mo...

Compound Q&A

What industries use 2-(2,6-Dioxo-3-piperidinyl)-5,6-difluoro-1H-isoindole-1,3(2H)-dione (CAS: 1496997-41-1)?

This compound is primarily used in the pharmaceutical industry for the synthesis of various drug can...

Compound Q&A

What precautions should be taken when handling 2-(2,6-Dioxo-3-piperidinyl)-5,6-difluoro-1H-isoindole-1,3(2H)-dione (CAS: 1496997-41-1)?

Proper personal protective equipment (PPE) including gloves, goggles, and a lab coat should be worn ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...