Compound Q&A

How is Lamivudine Salicylate (CAS: 173522-96-8) typically synthesized?

Answer

Lamivudine Salicylate
Lamivudine Salicylate (CAS: 173522-96-8) is synthesized through a multi-step process involving the salicylate esterification of lamivudine. The first step involves the preparation of lamivudine, which is then reacted with salicylic acid in the presence of a catalyst such as triethylamine. The reaction mixture is then purified through recrystallization to obtain the desired product with high yield and selectivity.

About

English Name Lamivudine Salicylate
Molecular Formula C15H15N3O5S
Molecular Weight 349.4 g/mol
SMILES C1C(OC(S1)COC(=O)C2=CC=CC=C2O)N3C=CC(=NC3=O)N
InChIKey MUAWHSKZVSAWMH-QWHCGFSZSA-N
Last Updated: 2025-11-01 12:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of Lamivudine Salicylate (CAS: 173522-96-8)?

Lamivudine Salicylate (CAS: 173522-96-8) is a crystalline compound with a molecular weight of approx...

Compound Q&A

What industries use Lamivudine Salicylate (CAS: 173522-96-8)?

Lamivudine Salicylate (CAS: 173522-96-8) is primarily used in the pharmaceutical industry, particula...

Compound Q&A

What precautions should be taken when handling Lamivudine Salicylate (CAS: 173522-96-8)?

When handling Lamivudine Salicylate (CAS: 173522-96-8), it is important to wear appropriate personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...