Compound Q&A

What precautions should be taken when handling Methyl 1-acetyl-2-oxo-6-indolinecarboxylate (CAS: 676326-36-6)?

Answer

Methyl 1-acetyl-2-oxo-6-indolinecarboxylate
When handling Methyl 1-acetyl-2-oxo-6-indolinecarboxylate, it is essential to wear appropriate personal protective equipment (PPE) such as gloves, safety goggles, and a lab coat. Work under a fume hood to minimize exposure. Spills should be cleaned up immediately using appropriate absorbents, and the area should be well-ventilated. Always refer to the Material Safety Data Sheet (MSDS) for detailed safety information.

About

English Name Methyl 1-acetyl-2-oxo-6-indolinecarboxylate
Molecular Formula C12H11NO4
Molecular Weight 233.22 g/mol
SMILES CC(=O)N1C(=O)CC2=C1C=C(C=C2)C(=O)OC
InChIKey QIMXPFXIAXDPBS-UHFFFAOYSA-N
Last Updated: 2025-11-01 12:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 1-acetyl-2-oxo-6-indolinecarboxylate (CAS: 676326-36-6)?

Methyl 1-acetyl-2-oxo-6-indolinecarboxylate is a crystalline compound with a molecular weight of app...

Compound Q&A

How is Methyl 1-acetyl-2-oxo-6-indolinecarboxylate (CAS: 676326-36-6) typically synthesized?

Methyl 1-acetyl-2-oxo-6-indolinecarboxylate can be synthesized through a multi-step process involvin...

Compound Q&A

What industries use Methyl 1-acetyl-2-oxo-6-indolinecarboxylate (CAS: 676326-36-6)?

Methyl 1-acetyl-2-oxo-6-indolinecarboxylate is primarily used in the pharmaceutical industry for the...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...