Compound Q&A

What industries use Methyl 1-acetyl-2-oxo-6-indolinecarboxylate (CAS: 676326-36-6)?

Answer

Methyl 1-acetyl-2-oxo-6-indolinecarboxylate
Methyl 1-acetyl-2-oxo-6-indolinecarboxylate is primarily used in the pharmaceutical industry for the synthesis of various bioactive compounds. It is also utilized in the research and development of new materials, particularly in polymer and sensor applications due to its unique chemical properties.

About

English Name Methyl 1-acetyl-2-oxo-6-indolinecarboxylate
Molecular Formula C12H11NO4
Molecular Weight 233.22 g/mol
SMILES CC(=O)N1C(=O)CC2=C1C=C(C=C2)C(=O)OC
InChIKey QIMXPFXIAXDPBS-UHFFFAOYSA-N
Last Updated: 2025-11-01 12:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 1-acetyl-2-oxo-6-indolinecarboxylate (CAS: 676326-36-6)?

Methyl 1-acetyl-2-oxo-6-indolinecarboxylate is a crystalline compound with a molecular weight of app...

Compound Q&A

How is Methyl 1-acetyl-2-oxo-6-indolinecarboxylate (CAS: 676326-36-6) typically synthesized?

Methyl 1-acetyl-2-oxo-6-indolinecarboxylate can be synthesized through a multi-step process involvin...

Compound Q&A

What precautions should be taken when handling Methyl 1-acetyl-2-oxo-6-indolinecarboxylate (CAS: 676326-36-6)?

When handling Methyl 1-acetyl-2-oxo-6-indolinecarboxylate, it is essential to wear appropriate perso...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...