Compound Q&A

What precautions should be taken when handling 4-[2,4,5-tris(4-carboxyphenyl)phenyl]benzoic acid (CAS: 1078153-58-8)?

Answer

4-[2,4,5-tris(4-carboxyphenyl)phenyl]benzoic acid
When handling 4-[2,4,5-tris(4-carboxyphenyl)phenyl]benzoic acid, it is essential to use appropriate personal protective equipment (PPE) such as gloves, safety goggles, and a lab coat. This compound is corrosive and may cause skin irritation or eye damage. It should be stored in a well-ventilated fume hood to avoid inhalation or skin contact. In case of a spill, it should be handled according to the safety data sheet (SDS) guidelines, and proper waste disposal procedures should be followed.

About

English Name 4-[2,4,5-tris(4-carboxyphenyl)phenyl]benzoic acid
Molecular Formula C34H22O8
Molecular Weight 558.54 g/mol
SMILES c1cc(ccc1c2cc(c(cc2c3ccc(cc3)C(=O)O)c4ccc(cc4)C(=O)O)c5ccc(cc5)C(=O)O)C(=O)O
InChIKey SRTQKANXPMBQCX-UHFFFAOYSA-N
Last Updated: 2025-11-01 12:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-[2,4,5-tris(4-carboxyphenyl)phenyl]benzoic acid (CAS: 1078153-58-8)?

4-[2,4,5-tris(4-carboxyphenyl)phenyl]benzoic acid is a white crystalline solid with a molecular weig...

Compound Q&A

How is 4-[2,4,5-tris(4-carboxyphenyl)phenyl]benzoic acid (CAS: 1078153-58-8) typically synthesized?

4-[2,4,5-tris(4-carboxyphenyl)phenyl]benzoic acid is synthesized through multistep reactions involvi...

Compound Q&A

What industries use 4-[2,4,5-tris(4-carboxyphenyl)phenyl]benzoic acid (CAS: 1078153-58-8)?

4-[2,4,5-tris(4-carboxyphenyl)phenyl]benzoic acid is used in the pharmaceutical industry for its pot...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...