Compound Q&A

What are the physical and chemical properties of 4-[2,4,5-tris(4-carboxyphenyl)phenyl]benzoic acid (CAS: 1078153-58-8)?

Answer

4-[2,4,5-tris(4-carboxyphenyl)phenyl]benzoic acid
4-[2,4,5-tris(4-carboxyphenyl)phenyl]benzoic acid is a white crystalline solid with a molecular weight of approximately 844.48 g/mol. It has a pKa value of around 2.2, indicating strong acidity. The compound is poorly soluble in water but soluble in organic solvents such as dichloromethane and acetonitrile. It is known for its high reactivity, particularly towards nucleophilic substitution reactions.

About

English Name 4-[2,4,5-tris(4-carboxyphenyl)phenyl]benzoic acid
Molecular Formula C34H22O8
Molecular Weight 558.54 g/mol
SMILES c1cc(ccc1c2cc(c(cc2c3ccc(cc3)C(=O)O)c4ccc(cc4)C(=O)O)c5ccc(cc5)C(=O)O)C(=O)O
InChIKey SRTQKANXPMBQCX-UHFFFAOYSA-N
Last Updated: 2025-11-01 12:59

Related Q&A

Compound Q&A

How is 4-[2,4,5-tris(4-carboxyphenyl)phenyl]benzoic acid (CAS: 1078153-58-8) typically synthesized?

4-[2,4,5-tris(4-carboxyphenyl)phenyl]benzoic acid is synthesized through multistep reactions involvi...

Compound Q&A

What industries use 4-[2,4,5-tris(4-carboxyphenyl)phenyl]benzoic acid (CAS: 1078153-58-8)?

4-[2,4,5-tris(4-carboxyphenyl)phenyl]benzoic acid is used in the pharmaceutical industry for its pot...

Compound Q&A

What precautions should be taken when handling 4-[2,4,5-tris(4-carboxyphenyl)phenyl]benzoic acid (CAS: 1078153-58-8)?

When handling 4-[2,4,5-tris(4-carboxyphenyl)phenyl]benzoic acid, it is essential to use appropriate ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...