Compound Q&A

What industries use Methyl 4-iodo-3-methoxybenzoate (CAS: 35387-92-9)?

Answer

Methyl 4-iodo-3-methoxybenzoate
Methyl 4-iodo-3-methoxybenzoate (CAS: 35387-92-9) is primarily used in the pharmaceutical and polymer industries. It serves as a precursor in the synthesis of pharmaceutical compounds and is also used in the development of advanced polymers with specific functional groups for various applications.

About

CAS No 35387-92-9
English Name Methyl 4-iodo-3-methoxybenzoate
Molecular Formula C9H9IO3
Molecular Weight 292.07 g/mol
SMILES COC1=C(C=CC(=C1)C(=O)OC)I
InChIKey GALFBPQYWHBOPA-UHFFFAOYSA-N
Last Updated: 2025-11-01 12:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 4-iodo-3-methoxybenzoate (CAS: 35387-92-9)?

Methyl 4-iodo-3-methoxybenzoate (CAS: 35387-92-9) is a crystalline compound with a molecular weight ...

Compound Q&A

How is Methyl 4-iodo-3-methoxybenzoate (CAS: 35387-92-9) typically synthesized?

Methyl 4-iodo-3-methoxybenzoate can be synthesized through a series of steps, starting from methyl 3...

Compound Q&A

What precautions should be taken when handling Methyl 4-iodo-3-methoxybenzoate (CAS: 35387-92-9)?

When handling Methyl 4-iodo-3-methoxybenzoate (CAS: 35387-92-9), wear appropriate personal protectiv...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...