Compound Q&A

What are the physical and chemical properties of Methyl 4-iodo-3-methoxybenzoate (CAS: 35387-92-9)?

Answer

Methyl 4-iodo-3-methoxybenzoate
Methyl 4-iodo-3-methoxybenzoate (CAS: 35387-92-9) is a crystalline compound with a molecular weight of approximately 326.02 g/mol. It has a low solubility in water but is more soluble in organic solvents. Chemically, it is highly reactive due to the presence of the iodine and methoxy groups, which can participate in various chemical reactions such as nucleophilic substitution and electrophilic aromatic substitution.

About

CAS No 35387-92-9
English Name Methyl 4-iodo-3-methoxybenzoate
Molecular Formula C9H9IO3
Molecular Weight 292.07 g/mol
SMILES COC1=C(C=CC(=C1)C(=O)OC)I
InChIKey GALFBPQYWHBOPA-UHFFFAOYSA-N
Last Updated: 2025-11-01 12:59

Related Q&A

Compound Q&A

How is Methyl 4-iodo-3-methoxybenzoate (CAS: 35387-92-9) typically synthesized?

Methyl 4-iodo-3-methoxybenzoate can be synthesized through a series of steps, starting from methyl 3...

Compound Q&A

What industries use Methyl 4-iodo-3-methoxybenzoate (CAS: 35387-92-9)?

Methyl 4-iodo-3-methoxybenzoate (CAS: 35387-92-9) is primarily used in the pharmaceutical and polyme...

Compound Q&A

What precautions should be taken when handling Methyl 4-iodo-3-methoxybenzoate (CAS: 35387-92-9)?

When handling Methyl 4-iodo-3-methoxybenzoate (CAS: 35387-92-9), wear appropriate personal protectiv...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...