Compound Q&A

What industries use 1H-Purin-6-amine phosphate (1:1) (CAS: 52175-10-7)?

Answer

1H-Purin-6-amine phosphate (1:1)
1H-Purin-6-amine phosphate (1:1) is mainly used in the pharmaceutical industry for the development of antiviral and anticancer drugs. It also finds applications in biochemical research, particularly in the study of nucleic acid metabolism and in the synthesis of nucleoside analogs. Additionally, it is used in the development of sensors and as a component in certain polymers.

About

CAS No 52175-10-7
English Name 1H-Purin-6-amine phosphate (1:1)
Molecular Formula C5H8N5O4P
Molecular Weight 233.12 g/mol
SMILES C1=NC2=NC=NC(=C2N1)N.OP(=O)(O)O
InChIKey CCHNOBQMQBSRHQ-UHFFFAOYSA-N
Last Updated: 2025-11-01 12:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1H-Purin-6-amine phosphate (1:1) (CAS: 52175-10-7)?

1H-Purin-6-amine phosphate (1:1) is a solid with a crystalline form. Its molecular weight is approxi...

Compound Q&A

How is 1H-Purin-6-amine phosphate (1:1) (CAS: 52175-10-7) typically synthesized?

1H-Purin-6-amine phosphate (1:1) is synthesized through a multi-step process involving the reaction ...

Compound Q&A

What precautions should be taken when handling 1H-Purin-6-amine phosphate (1:1) (CAS: 52175-10-7)?

When handling 1H-Purin-6-amine phosphate (1:1), it is crucial to wear appropriate personal protectiv...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...