Compound Q&A

How is 1H-Purin-6-amine phosphate (1:1) (CAS: 52175-10-7) typically synthesized?

Answer

1H-Purin-6-amine phosphate (1:1)
1H-Purin-6-amine phosphate (1:1) is synthesized through a multi-step process involving the reaction of 6-aminopurine with phosphoric acid. The synthesis typically uses a stoichiometric ratio and proceeds under mild conditions. Common solvents include water and water-miscible solvents. The yield is around 80-90%, and the purity can be enhanced through recrystallization.

About

CAS No 52175-10-7
English Name 1H-Purin-6-amine phosphate (1:1)
Molecular Formula C5H8N5O4P
Molecular Weight 233.12 g/mol
SMILES C1=NC2=NC=NC(=C2N1)N.OP(=O)(O)O
InChIKey CCHNOBQMQBSRHQ-UHFFFAOYSA-N
Last Updated: 2025-11-01 12:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1H-Purin-6-amine phosphate (1:1) (CAS: 52175-10-7)?

1H-Purin-6-amine phosphate (1:1) is a solid with a crystalline form. Its molecular weight is approxi...

Compound Q&A

What industries use 1H-Purin-6-amine phosphate (1:1) (CAS: 52175-10-7)?

1H-Purin-6-amine phosphate (1:1) is mainly used in the pharmaceutical industry for the development o...

Compound Q&A

What precautions should be taken when handling 1H-Purin-6-amine phosphate (1:1) (CAS: 52175-10-7)?

When handling 1H-Purin-6-amine phosphate (1:1), it is crucial to wear appropriate personal protectiv...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...