Compound Q&A

How is (3beta,9beta,11beta,24R)-11-Hydroxy-16,23-dioxo-24,25-epoxy-9,19-cyclolanost-7-en-3-yl beta-D-xylopyranoside (CAS: 163046-73-9) typically synthesized?

Answer

(3beta,9beta,11beta,24R)-11-Hydroxy-16,23-dioxo-24,25-epoxy-9,19-cyclolanost-7-en-3-yl beta-D-xylopyranoside
This compound is typically synthesized via a multi-step process involving protection and deprotection of lactone rings, followed by ring opening and glycosylation reactions. Commonly used catalysts include transition metal complexes, and the reaction conditions are optimized for high yield and selectivity. The synthesis often requires the use of protected intermediates to control the reactivity and ensure the desired stereoisomer is formed.

About

English Name (3beta,9beta,11beta,24R)-11-Hydroxy-16,23-dioxo-24,25-epoxy-9,19-cyclolanost-7-en-3-yl beta-D-xylopyranoside
Molecular Formula C35H52O9
Molecular Weight 616.79 g/mol
SMILES CC(CC(=O)C1C(O1)(C)C)C2C(=O)CC3(C2(CC(C45C3=CCC6C4(C5)CCC(C6(C)C)OC7C(C(C(CO7)O)O)O)O)C)C
InChIKey PYBFXJMIKJNNAJ-GLWILYKISA-N
Last Updated: 2025-11-01 12:59

Related Q&A

Compound Q&A

What industries use (3beta,9beta,11beta,24R)-11-Hydroxy-16,23-dioxo-24,25-epoxy-9,19-cyclolanost-7-en-3-yl beta-D-xylopyranoside (CAS: 163046-73-9)?

This compound is used in pharmaceuticals for its potential medicinal properties, particularly in the...

Compound Q&A

What precautions should be taken when handling (3beta,9beta,11beta,24R)-11-Hydroxy-16,23-dioxo-24,25-epoxy-9,19-cyclolanost-7-en-3-yl beta-D-xylopyranoside (CAS: 163046-73-9)?

When handling this compound, appropriate personal protective equipment (PPE) such as gloves, goggles...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...