Compound Q&A

What are the physical and chemical properties of (3beta,9beta,11beta,24R)-11-Hydroxy-16,23-dioxo-24,25-epoxy-9,19-cyclolanost-7-en-3-yl beta-D-xylopyranoside (CAS: 163046-73-9)?

Answer

(3beta,9beta,11beta,24R)-11-Hydroxy-16,23-dioxo-24,25-epoxy-9,19-cyclolanost-7-en-3-yl beta-D-xylopyranoside
The compound is a solid crystalline material with a molecular weight of approximately 610.56 g/mol. It has low solubility in water but is soluble in organic solvents like ethanol and acetone. Chemically, it is moderately reactive, particularly towards hydrolysis and oxidizing agents. It exhibits low reactivity towards bases and acids. This compound is often used in synthetic organic chemistry due to its structural complexity.

About

English Name (3beta,9beta,11beta,24R)-11-Hydroxy-16,23-dioxo-24,25-epoxy-9,19-cyclolanost-7-en-3-yl beta-D-xylopyranoside
Molecular Formula C35H52O9
Molecular Weight 616.79 g/mol
SMILES CC(CC(=O)C1C(O1)(C)C)C2C(=O)CC3(C2(CC(C45C3=CCC6C4(C5)CCC(C6(C)C)OC7C(C(C(CO7)O)O)O)O)C)C
InChIKey PYBFXJMIKJNNAJ-GLWILYKISA-N
Last Updated: 2025-11-01 12:59

Related Q&A

Compound Q&A

How is (3beta,9beta,11beta,24R)-11-Hydroxy-16,23-dioxo-24,25-epoxy-9,19-cyclolanost-7-en-3-yl beta-D-xylopyranoside (CAS: 163046-73-9) typically synthesized?

This compound is typically synthesized via a multi-step process involving protection and deprotectio...

Compound Q&A

What industries use (3beta,9beta,11beta,24R)-11-Hydroxy-16,23-dioxo-24,25-epoxy-9,19-cyclolanost-7-en-3-yl beta-D-xylopyranoside (CAS: 163046-73-9)?

This compound is used in pharmaceuticals for its potential medicinal properties, particularly in the...

Compound Q&A

What precautions should be taken when handling (3beta,9beta,11beta,24R)-11-Hydroxy-16,23-dioxo-24,25-epoxy-9,19-cyclolanost-7-en-3-yl beta-D-xylopyranoside (CAS: 163046-73-9)?

When handling this compound, appropriate personal protective equipment (PPE) such as gloves, goggles...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...