Compound Q&A

What industries use 1-(3-Fluoro-4-nitrophenyl)ethanone (CAS: 72802-25-6)?

Answer

1-(3-Fluoro-4-nitrophenyl)ethanone
1-(3-Fluoro-4-nitrophenyl)ethanone (CAS: 72802-25-6) is utilized in various industries, particularly in the pharmaceutical and chemical sectors. It serves as a valuable intermediate in the synthesis of other compounds, such as dyes, pharmaceuticals, and organic materials. Its use in the polymer industry is also noted, where it contributes to the development of new materials with specific properties.

About

CAS No 72802-25-6
English Name 1-(3-Fluoro-4-nitrophenyl)ethanone
Molecular Formula C8H6FNO3
Molecular Weight 183.1365 g/mol
SMILES CC(=O)C1=CC(=C(C=C1)[N+](=O)[O-])F
InChIKey UHAATBAYLFRWMR-UHFFFAOYSA-N
Last Updated: 2025-11-01 12:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-(3-Fluoro-4-nitrophenyl)ethanone (CAS: 72802-25-6)?

1-(3-Fluoro-4-nitrophenyl)ethanone (CAS: 72802-25-6) is a crystalline compound with a molecular weig...

Compound Q&A

How is 1-(3-Fluoro-4-nitrophenyl)ethanone (CAS: 72802-25-6) typically synthesized?

1-(3-Fluoro-4-nitrophenyl)ethanone is typically synthesized by nitration of 1-(3-fluorophenyl)ethano...

Compound Q&A

What precautions should be taken when handling 1-(3-Fluoro-4-nitrophenyl)ethanone (CAS: 72802-25-6)?

When handling 1-(3-Fluoro-4-nitrophenyl)ethanone (CAS: 72802-25-6), it is crucial to wear appropriat...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...