Compound Q&A

How is 1-(3-Fluoro-4-nitrophenyl)ethanone (CAS: 72802-25-6) typically synthesized?

Answer

1-(3-Fluoro-4-nitrophenyl)ethanone
1-(3-Fluoro-4-nitrophenyl)ethanone is typically synthesized by nitration of 1-(3-fluorophenyl)ethanone. The nitration reaction is carried out in the presence of a strong acid, such as sulfuric acid, and nitric acid. The reaction is exothermic and requires careful temperature control to ensure selectivity and yield. Common solvents used include acetic anhydride or acetic acid, with water as the inorganic acid source.

About

CAS No 72802-25-6
English Name 1-(3-Fluoro-4-nitrophenyl)ethanone
Molecular Formula C8H6FNO3
Molecular Weight 183.1365 g/mol
SMILES CC(=O)C1=CC(=C(C=C1)[N+](=O)[O-])F
InChIKey UHAATBAYLFRWMR-UHFFFAOYSA-N
Last Updated: 2025-11-01 12:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-(3-Fluoro-4-nitrophenyl)ethanone (CAS: 72802-25-6)?

1-(3-Fluoro-4-nitrophenyl)ethanone (CAS: 72802-25-6) is a crystalline compound with a molecular weig...

Compound Q&A

What industries use 1-(3-Fluoro-4-nitrophenyl)ethanone (CAS: 72802-25-6)?

1-(3-Fluoro-4-nitrophenyl)ethanone (CAS: 72802-25-6) is utilized in various industries, particularly...

Compound Q&A

What precautions should be taken when handling 1-(3-Fluoro-4-nitrophenyl)ethanone (CAS: 72802-25-6)?

When handling 1-(3-Fluoro-4-nitrophenyl)ethanone (CAS: 72802-25-6), it is crucial to wear appropriat...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...