Compound Q&A

What are the physical and chemical properties of 1-(3-Fluoro-4-nitrophenyl)ethanone (CAS: 72802-25-6)?

Answer

1-(3-Fluoro-4-nitrophenyl)ethanone
1-(3-Fluoro-4-nitrophenyl)ethanone (CAS: 72802-25-6) is a crystalline compound with a molecular weight of approximately 229.04 g/mol. It has a low solubility in water but is more soluble in organic solvents like ethanol and acetone. The compound is moderately reactive, particularly towards nucleophiles and reducing agents. It can undergo various transformations, such as reduction, halogenation, and nitration, under appropriate conditions.

About

CAS No 72802-25-6
English Name 1-(3-Fluoro-4-nitrophenyl)ethanone
Molecular Formula C8H6FNO3
Molecular Weight 183.1365 g/mol
SMILES CC(=O)C1=CC(=C(C=C1)[N+](=O)[O-])F
InChIKey UHAATBAYLFRWMR-UHFFFAOYSA-N
Last Updated: 2025-11-01 12:59

Related Q&A

Compound Q&A

How is 1-(3-Fluoro-4-nitrophenyl)ethanone (CAS: 72802-25-6) typically synthesized?

1-(3-Fluoro-4-nitrophenyl)ethanone is typically synthesized by nitration of 1-(3-fluorophenyl)ethano...

Compound Q&A

What industries use 1-(3-Fluoro-4-nitrophenyl)ethanone (CAS: 72802-25-6)?

1-(3-Fluoro-4-nitrophenyl)ethanone (CAS: 72802-25-6) is utilized in various industries, particularly...

Compound Q&A

What precautions should be taken when handling 1-(3-Fluoro-4-nitrophenyl)ethanone (CAS: 72802-25-6)?

When handling 1-(3-Fluoro-4-nitrophenyl)ethanone (CAS: 72802-25-6), it is crucial to wear appropriat...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...