Compound Q&A

What industries use Decarboxyl ofloxacin (CAS: 178964-53-9)?

Answer

Decarboxyl ofloxacin, (S)-
Decarboxyl ofloxacin (CAS: 178964-53-9) is primarily used in the pharmaceutical industry for the development of new antibiotics. It also has applications in the polymer industry as a stabilizer and in the production of semiconductors due to its electronic properties.

About

English Name Decarboxyl ofloxacin, (S)-
Molecular Formula C17H20FN3O2
Molecular Weight 317.36 g/mol
SMILES CC1COC2=C3N1C=CC(=O)C3=CC(=C2N4CCN(CC4)C)F
InChIKey XTLCAWXSWVQNHK-NSHDSACASA-N
Last Updated: 2025-10-31 20:53

Related Q&A

Compound Q&A

What are the physical and chemical properties of Decarboxyl ofloxacin (CAS: 178964-53-9)?

Decarboxyl ofloxacin (CAS: 178964-53-9) is a crystalline compound with a molecular weight of approxi...

Compound Q&A

How is Decarboxyl ofloxacin (CAS: 178964-53-9) typically synthesized?

Decarboxyl ofloxacin (CAS: 178964-53-9) is synthesized by decarboxylation of ofloxacin under mild ba...

Compound Q&A

What precautions should be taken when handling Decarboxyl ofloxacin (CAS: 178964-53-9)?

When handling Decarboxyl ofloxacin (CAS: 178964-53-9), it is essential to wear appropriate personal ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...