Compound Q&A

What are the physical and chemical properties of Decarboxyl ofloxacin (CAS: 178964-53-9)?

Answer

Decarboxyl ofloxacin, (S)-
Decarboxyl ofloxacin (CAS: 178964-53-9) is a crystalline compound with a molecular weight of approximately 423.44 g/mol. It has a high solubility in water and moderate solubility in organic solvents. The compound is relatively stable under normal conditions but can degrade upon exposure to light and heat. It reacts readily with bases to form the corresponding salts.

About

English Name Decarboxyl ofloxacin, (S)-
Molecular Formula C17H20FN3O2
Molecular Weight 317.36 g/mol
SMILES CC1COC2=C3N1C=CC(=O)C3=CC(=C2N4CCN(CC4)C)F
InChIKey XTLCAWXSWVQNHK-NSHDSACASA-N
Last Updated: 2025-10-31 20:53

Related Q&A

Compound Q&A

How is Decarboxyl ofloxacin (CAS: 178964-53-9) typically synthesized?

Decarboxyl ofloxacin (CAS: 178964-53-9) is synthesized by decarboxylation of ofloxacin under mild ba...

Compound Q&A

What industries use Decarboxyl ofloxacin (CAS: 178964-53-9)?

Decarboxyl ofloxacin (CAS: 178964-53-9) is primarily used in the pharmaceutical industry for the dev...

Compound Q&A

What precautions should be taken when handling Decarboxyl ofloxacin (CAS: 178964-53-9)?

When handling Decarboxyl ofloxacin (CAS: 178964-53-9), it is essential to wear appropriate personal ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...