Compound Q&A

What precautions should be taken when handling (4-Cyano-3-methoxyphenyl)boronic acid (CAS: 677777-45-6)?

Answer

(4-Cyano-3-methoxyphenyl)boronic acid
When handling (4-Cyano-3-methoxyphenyl)boronic acid, it is essential to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. It should be handled in a well-ventilated fume hood to minimize inhalation risk. Spills should be immediately cleaned up with appropriate absorbent materials, and proper disposal methods should be followed as per the safety data sheet (SDS).

About

English Name (4-Cyano-3-methoxyphenyl)boronic acid
Molecular Formula C8H8BNO3
Molecular Weight 165.98 g/mol
SMILES B(C1=CC(=C(C=C1)C#N)OC)(O)O
InChIKey YWZHJSBHFAFASK-UHFFFAOYSA-N
Last Updated: 2025-10-31 20:53

Related Q&A

Compound Q&A

What are the physical and chemical properties of (4-Cyano-3-methoxyphenyl)boronic acid (CAS: 677777-45-6)?

(4-Cyano-3-methoxyphenyl)boronic acid is a white crystalline solid with a molecular weight of approx...

Compound Q&A

How is (4-Cyano-3-methoxyphenyl)boronic acid (CAS: 677777-45-6) typically synthesized?

(4-Cyano-3-methoxyphenyl)boronic acid is commonly synthesized through the arylation of (4-cyano-3-me...

Compound Q&A

What industries use (4-Cyano-3-methoxyphenyl)boronic acid (CAS: 677777-45-6)?

(4-Cyano-3-methoxyphenyl)boronic acid finds applications in the pharmaceutical industry for the synt...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...