Compound Q&A

What industries use (4-Cyano-3-methoxyphenyl)boronic acid (CAS: 677777-45-6)?

Answer

(4-Cyano-3-methoxyphenyl)boronic acid
(4-Cyano-3-methoxyphenyl)boronic acid finds applications in the pharmaceutical industry for the synthesis of complex molecules, in the production of polymers for electronic and optical applications, and in the development of sensors for detecting various analytes. It is also used in semiconductor manufacturing due to its ability to participate in cross-coupling reactions.

About

English Name (4-Cyano-3-methoxyphenyl)boronic acid
Molecular Formula C8H8BNO3
Molecular Weight 165.98 g/mol
SMILES B(C1=CC(=C(C=C1)C#N)OC)(O)O
InChIKey YWZHJSBHFAFASK-UHFFFAOYSA-N
Last Updated: 2025-10-31 20:53

Related Q&A

Compound Q&A

What are the physical and chemical properties of (4-Cyano-3-methoxyphenyl)boronic acid (CAS: 677777-45-6)?

(4-Cyano-3-methoxyphenyl)boronic acid is a white crystalline solid with a molecular weight of approx...

Compound Q&A

How is (4-Cyano-3-methoxyphenyl)boronic acid (CAS: 677777-45-6) typically synthesized?

(4-Cyano-3-methoxyphenyl)boronic acid is commonly synthesized through the arylation of (4-cyano-3-me...

Compound Q&A

What precautions should be taken when handling (4-Cyano-3-methoxyphenyl)boronic acid (CAS: 677777-45-6)?

When handling (4-Cyano-3-methoxyphenyl)boronic acid, it is essential to wear appropriate personal pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...