Compound Q&A

What are the physical and chemical properties of (4-Cyano-3-methoxyphenyl)boronic acid (CAS: 677777-45-6)?

Answer

(4-Cyano-3-methoxyphenyl)boronic acid
(4-Cyano-3-methoxyphenyl)boronic acid is a white crystalline solid with a molecular weight of approximately 256.17 g/mol. It is poorly soluble in water but soluble in common organic solvents like ethanol and acetone. The compound shows moderate reactivity, particularly in boron hydride reactions and in coupling reactions with halides under palladium catalysis.

About

English Name (4-Cyano-3-methoxyphenyl)boronic acid
Molecular Formula C8H8BNO3
Molecular Weight 165.98 g/mol
SMILES B(C1=CC(=C(C=C1)C#N)OC)(O)O
InChIKey YWZHJSBHFAFASK-UHFFFAOYSA-N
Last Updated: 2025-10-31 20:53

Related Q&A

Compound Q&A

How is (4-Cyano-3-methoxyphenyl)boronic acid (CAS: 677777-45-6) typically synthesized?

(4-Cyano-3-methoxyphenyl)boronic acid is commonly synthesized through the arylation of (4-cyano-3-me...

Compound Q&A

What industries use (4-Cyano-3-methoxyphenyl)boronic acid (CAS: 677777-45-6)?

(4-Cyano-3-methoxyphenyl)boronic acid finds applications in the pharmaceutical industry for the synt...

Compound Q&A

What precautions should be taken when handling (4-Cyano-3-methoxyphenyl)boronic acid (CAS: 677777-45-6)?

When handling (4-Cyano-3-methoxyphenyl)boronic acid, it is essential to wear appropriate personal pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...