Compound Q&A

How is [Pyr1]-Apelin-13 (CAS: 217082-60-5) typically synthesized?

Answer

[Pyr1]-Apelin-13
[Pyr1]-Apelin-13 is synthesized via solid-phase peptide synthesis (SPPS) using Fmoc chemistry. The synthesis involves the stepwise addition of amino acids to a growing peptide chain on a solid support. Commonly used catalysts include HATU or DCC. The final product is cleaved from the solid support using strong acids like trifluoroacetic acid (TFA).

About

English Name [Pyr1]-Apelin-13
Molecular Formula C69H108N22O16S
Molecular Weight 1533.8 g/mol
SMILES CC(C)CC(C(=O)NC(CO)C(=O)NC(CC1=CN=CN1)C(=O)NC(CCCCN)C(=O)NCC(=O)N2CCCC2C(=O)NC(CCSC)C(=O)N3CCCC3C(=O)NC(CC4=CC=CC=C4)C(=O)O)NC(=O)C(CCCN=C(N)N)NC(=O)C5CCCN5C(=O)C(CCCN=C(N)N)NC(=O)C6CCC(=O)N6
InChIKey GGMAXEWLXWJGSF-PEWBXTNBSA-N
Last Updated: 2025-10-31 20:53

Related Q&A

Compound Q&A

What are the physical and chemical properties of [Pyr1]-Apelin-13 (CAS: 217082-60-5)?

[Pyr1]-Apelin-13 is a peptide with a molecular weight of approximately 721.56 g/mol. It is somewhat ...

Compound Q&A

What industries use [Pyr1]-Apelin-13 (CAS: 217082-60-5)?

[Pyr1]-Apelin-13 is primarily used in the pharmaceutical industry for research and development of po...

Compound Q&A

What precautions should be taken when handling [Pyr1]-Apelin-13 (CAS: 217082-60-5)?

When handling [Pyr1]-Apelin-13, wear appropriate personal protective equipment (PPE) such as gloves ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...