Compound Q&A

What are the physical and chemical properties of [Pyr1]-Apelin-13 (CAS: 217082-60-5)?

Answer

[Pyr1]-Apelin-13
[Pyr1]-Apelin-13 is a peptide with a molecular weight of approximately 721.56 g/mol. It is somewhat soluble in water and has a crystalline form. The compound is stable under normal conditions but reacts with bases to form salts. It is not flammable but should be handled with care due to potential irritancy.

About

English Name [Pyr1]-Apelin-13
Molecular Formula C69H108N22O16S
Molecular Weight 1533.8 g/mol
SMILES CC(C)CC(C(=O)NC(CO)C(=O)NC(CC1=CN=CN1)C(=O)NC(CCCCN)C(=O)NCC(=O)N2CCCC2C(=O)NC(CCSC)C(=O)N3CCCC3C(=O)NC(CC4=CC=CC=C4)C(=O)O)NC(=O)C(CCCN=C(N)N)NC(=O)C5CCCN5C(=O)C(CCCN=C(N)N)NC(=O)C6CCC(=O)N6
InChIKey GGMAXEWLXWJGSF-PEWBXTNBSA-N
Last Updated: 2025-10-31 20:53

Related Q&A

Compound Q&A

How is [Pyr1]-Apelin-13 (CAS: 217082-60-5) typically synthesized?

[Pyr1]-Apelin-13 is synthesized via solid-phase peptide synthesis (SPPS) using Fmoc chemistry. The s...

Compound Q&A

What industries use [Pyr1]-Apelin-13 (CAS: 217082-60-5)?

[Pyr1]-Apelin-13 is primarily used in the pharmaceutical industry for research and development of po...

Compound Q&A

What precautions should be taken when handling [Pyr1]-Apelin-13 (CAS: 217082-60-5)?

When handling [Pyr1]-Apelin-13, wear appropriate personal protective equipment (PPE) such as gloves ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...