Compound Q&A

How is 2,2,6,6-Tetramethyl-4-piperidinone hydrochloride (CAS: 33973-59-0) typically synthesized?

Answer

2,2,6,6-Tetramethyl-4-piperidinone hydrochloride (1:1)
2,2,6,6-Tetramethyl-4-piperidinone hydrochloride is typically synthesized by the reaction of 2,2,6,6-tetramethyl-1-piperidinyloxy (TEMPO) with hydrochloric acid. The process involves the protonation of TEMPO, followed by chlorination. Suitable catalysts and reagents include hydrochloric acid and chlorine gas, with high selectivity and moderate yield.

About

CAS No 33973-59-0
English Name 2,2,6,6-Tetramethyl-4-piperidinone hydrochloride (1:1)
Molecular Formula C9H18ClNO
Molecular Weight 191.7 g/mol
SMILES CC1(CC(=O)CC(N1)(C)C)C.Cl
InChIKey ZXNWYMNKYXUZGM-UHFFFAOYSA-N
Last Updated: 2025-10-31 20:53

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,2,6,6-Tetramethyl-4-piperidinone hydrochloride (CAS: 33973-59-0)?

2,2,6,6-Tetramethyl-4-piperidinone hydrochloride (CAS: 33973-59-0) is a crystalline compound with a ...

Compound Q&A

What industries use 2,2,6,6-Tetramethyl-4-piperidinone hydrochloride (CAS: 33973-59-0)?

2,2,6,6-Tetramethyl-4-piperidinone hydrochloride (CAS: 33973-59-0) is widely used in the pharmaceuti...

Compound Q&A

What precautions should be taken when handling 2,2,6,6-Tetramethyl-4-piperidinone hydrochloride (CAS: 33973-59-0)?

When handling 2,2,6,6-Tetramethyl-4-piperidinone hydrochloride (CAS: 33973-59-0), it is essential to...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...