Compound Q&A

What are the physical and chemical properties of 2,2,6,6-Tetramethyl-4-piperidinone hydrochloride (CAS: 33973-59-0)?

Answer

2,2,6,6-Tetramethyl-4-piperidinone hydrochloride (1:1)
2,2,6,6-Tetramethyl-4-piperidinone hydrochloride (CAS: 33973-59-0) is a crystalline compound with a molecular weight of approximately 228.7 g/mol. It has a solubility of about 60 g/L in water and is slightly soluble in ethanol. It is chemically stable but reacts with strong oxidizing agents. It is a common intermediate in organic synthesis and is used as a stabilizer in various applications.

About

CAS No 33973-59-0
English Name 2,2,6,6-Tetramethyl-4-piperidinone hydrochloride (1:1)
Molecular Formula C9H18ClNO
Molecular Weight 191.7 g/mol
SMILES CC1(CC(=O)CC(N1)(C)C)C.Cl
InChIKey ZXNWYMNKYXUZGM-UHFFFAOYSA-N
Last Updated: 2025-10-31 20:53

Related Q&A

Compound Q&A

How is 2,2,6,6-Tetramethyl-4-piperidinone hydrochloride (CAS: 33973-59-0) typically synthesized?

2,2,6,6-Tetramethyl-4-piperidinone hydrochloride is typically synthesized by the reaction of 2,2,6,6...

Compound Q&A

What industries use 2,2,6,6-Tetramethyl-4-piperidinone hydrochloride (CAS: 33973-59-0)?

2,2,6,6-Tetramethyl-4-piperidinone hydrochloride (CAS: 33973-59-0) is widely used in the pharmaceuti...

Compound Q&A

What precautions should be taken when handling 2,2,6,6-Tetramethyl-4-piperidinone hydrochloride (CAS: 33973-59-0)?

When handling 2,2,6,6-Tetramethyl-4-piperidinone hydrochloride (CAS: 33973-59-0), it is essential to...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...