Compound Q&A

What precautions should be taken when handling (R)-3,3'-Bis(phenyl)-1,1'-bi-2-naphthol (CAS: 102490-05-1)?

Answer

(R)-3,3'-Bis(phenyl)-1,1'-bi-2-naphthol
When handling (R)-3,3'-Bis(phenyl)-1,1'-bi-2-naphthol, it is crucial to wear appropriate personal protective equipment (PPE), including gloves, goggles, and a lab coat. The substance should be handled in a well-ventilated area or a fume hood to minimize exposure. In case of a spill, it is recommended to use absorbent materials and follow proper disposal procedures. Always consult the Safety Data Sheet (SDS) for detailed safety information and emergency procedures.

About

English Name (R)-3,3'-Bis(phenyl)-1,1'-bi-2-naphthol
Molecular Formula C32H22O2
Molecular Weight 438.53 g/mol
SMILES C1=CC=C(C=C1)C2=CC3=CC=CC=C3C(=C2O)C4=C(C(=CC5=CC=CC=C54)C6=CC=CC=C6)O
InChIKey UXSXQZYUHXUTTI-UHFFFAOYSA-N
Last Updated: 2025-10-31 20:53

Related Q&A

Compound Q&A

What are the physical and chemical properties of (R)-3,3'-Bis(phenyl)-1,1'-bi-2-naphthol (CAS: 102490-05-1)?

(R)-3,3'-Bis(phenyl)-1,1'-bi-2-naphthol is a white crystalline solid with a molecular weight of appr...

Compound Q&A

How is (R)-3,3'-Bis(phenyl)-1,1'-bi-2-naphthol (CAS: 102490-05-1) typically synthesized?

(R)-3,3'-Bis(phenyl)-1,1'-bi-2-naphthol can be synthesized via a multistep process involving the con...

Compound Q&A

What industries use (R)-3,3'-Bis(phenyl)-1,1'-bi-2-naphthol (CAS: 102490-05-1)?

(R)-3,3'-Bis(phenyl)-1,1'-bi-2-naphthol is used in various industries due to its unique chemical pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...