Compound Q&A

What are the physical and chemical properties of (R)-3,3'-Bis(phenyl)-1,1'-bi-2-naphthol (CAS: 102490-05-1)?

Answer

(R)-3,3'-Bis(phenyl)-1,1'-bi-2-naphthol
(R)-3,3'-Bis(phenyl)-1,1'-bi-2-naphthol is a white crystalline solid with a molecular weight of approximately 328.27 g/mol. It has a low solubility in water but is soluble in common organic solvents like ethanol and acetone. This compound is relatively stable under normal conditions but may react with strong acids or bases. It is also known for its high reactivity towards electrophilic aromatic substitution reactions.

About

English Name (R)-3,3'-Bis(phenyl)-1,1'-bi-2-naphthol
Molecular Formula C32H22O2
Molecular Weight 438.53 g/mol
SMILES C1=CC=C(C=C1)C2=CC3=CC=CC=C3C(=C2O)C4=C(C(=CC5=CC=CC=C54)C6=CC=CC=C6)O
InChIKey UXSXQZYUHXUTTI-UHFFFAOYSA-N
Last Updated: 2025-10-31 20:53

Related Q&A

Compound Q&A

How is (R)-3,3'-Bis(phenyl)-1,1'-bi-2-naphthol (CAS: 102490-05-1) typically synthesized?

(R)-3,3'-Bis(phenyl)-1,1'-bi-2-naphthol can be synthesized via a multistep process involving the con...

Compound Q&A

What industries use (R)-3,3'-Bis(phenyl)-1,1'-bi-2-naphthol (CAS: 102490-05-1)?

(R)-3,3'-Bis(phenyl)-1,1'-bi-2-naphthol is used in various industries due to its unique chemical pro...

Compound Q&A

What precautions should be taken when handling (R)-3,3'-Bis(phenyl)-1,1'-bi-2-naphthol (CAS: 102490-05-1)?

When handling (R)-3,3'-Bis(phenyl)-1,1'-bi-2-naphthol, it is crucial to wear appropriate personal pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...