Compound Q&A

How is (R)-3,3'-Bis(phenyl)-1,1'-bi-2-naphthol (CAS: 102490-05-1) typically synthesized?

Answer

(R)-3,3'-Bis(phenyl)-1,1'-bi-2-naphthol
(R)-3,3'-Bis(phenyl)-1,1'-bi-2-naphthol can be synthesized via a multistep process involving the condensation of 2-naphthol with phenyl chlorides. The reaction is typically catalyzed by a base such as sodium hydroxide, and the product is obtained with moderate to good yield. The process requires careful control of reaction conditions to achieve high selectivity and yield.

About

English Name (R)-3,3'-Bis(phenyl)-1,1'-bi-2-naphthol
Molecular Formula C32H22O2
Molecular Weight 438.53 g/mol
SMILES C1=CC=C(C=C1)C2=CC3=CC=CC=C3C(=C2O)C4=C(C(=CC5=CC=CC=C54)C6=CC=CC=C6)O
InChIKey UXSXQZYUHXUTTI-UHFFFAOYSA-N
Last Updated: 2025-10-31 20:53

Related Q&A

Compound Q&A

What are the physical and chemical properties of (R)-3,3'-Bis(phenyl)-1,1'-bi-2-naphthol (CAS: 102490-05-1)?

(R)-3,3'-Bis(phenyl)-1,1'-bi-2-naphthol is a white crystalline solid with a molecular weight of appr...

Compound Q&A

What industries use (R)-3,3'-Bis(phenyl)-1,1'-bi-2-naphthol (CAS: 102490-05-1)?

(R)-3,3'-Bis(phenyl)-1,1'-bi-2-naphthol is used in various industries due to its unique chemical pro...

Compound Q&A

What precautions should be taken when handling (R)-3,3'-Bis(phenyl)-1,1'-bi-2-naphthol (CAS: 102490-05-1)?

When handling (R)-3,3'-Bis(phenyl)-1,1'-bi-2-naphthol, it is crucial to wear appropriate personal pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...