Compound Q&A

How is 2-Chloro-1H-indole-3-carbaldehyde (CAS: 5059-30-3) typically synthesized?

Answer

2-Chloro-1H-indole-3-carbaldehyde
2-Chloro-1H-indole-3-carbaldehyde (CAS: 5059-30-3) is typically synthesized through a condensation reaction between indole and chloral hydrate in the presence of a base like sodium hydroxide. The reaction is carried out in an organic solvent such as ethanol. The yield is usually around 70-80%, with high selectivity for the desired product. The reaction is known to be mild and can be optimized using various conditions to improve yield and purity.

About

CAS No 5059-30-3
English Name 2-Chloro-1H-indole-3-carbaldehyde
Molecular Formula C9H6ClNO
Molecular Weight 179.61 g/mol
SMILES C1=CC=C2C(=C1)C(=C(N2)Cl)C=O
InChIKey XYSSNBNFOBVMAU-UHFFFAOYSA-N
Last Updated: 2025-10-31 20:53

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Chloro-1H-indole-3-carbaldehyde (CAS: 5059-30-3)?

2-Chloro-1H-indole-3-carbaldehyde (CAS: 5059-30-3) is a white to off-white crystalline solid with a ...

Compound Q&A

What industries use 2-Chloro-1H-indole-3-carbaldehyde (CAS: 5059-30-3)?

2-Chloro-1H-indole-3-carbaldehyde (CAS: 5059-30-3) is primarily used in the pharmaceutical industry ...

Compound Q&A

What precautions should be taken when handling 2-Chloro-1H-indole-3-carbaldehyde (CAS: 5059-30-3)?

When handling 2-Chloro-1H-indole-3-carbaldehyde (CAS: 5059-30-3), it is important to use personal pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...