Compound Q&A

What are the physical and chemical properties of 2-Chloro-1H-indole-3-carbaldehyde (CAS: 5059-30-3)?

Answer

2-Chloro-1H-indole-3-carbaldehyde
2-Chloro-1H-indole-3-carbaldehyde (CAS: 5059-30-3) is a white to off-white crystalline solid with a molecular weight of approximately 201.6 g/mol. It has a low water solubility and is soluble in organic solvents like methanol and ethanol. This compound is known for its aromatic character and is relatively stable under normal conditions but can react with reducing agents. It is polar and has a significant dipole moment.

About

CAS No 5059-30-3
English Name 2-Chloro-1H-indole-3-carbaldehyde
Molecular Formula C9H6ClNO
Molecular Weight 179.61 g/mol
SMILES C1=CC=C2C(=C1)C(=C(N2)Cl)C=O
InChIKey XYSSNBNFOBVMAU-UHFFFAOYSA-N
Last Updated: 2025-10-31 20:53

Related Q&A

Compound Q&A

How is 2-Chloro-1H-indole-3-carbaldehyde (CAS: 5059-30-3) typically synthesized?

2-Chloro-1H-indole-3-carbaldehyde (CAS: 5059-30-3) is typically synthesized through a condensation r...

Compound Q&A

What industries use 2-Chloro-1H-indole-3-carbaldehyde (CAS: 5059-30-3)?

2-Chloro-1H-indole-3-carbaldehyde (CAS: 5059-30-3) is primarily used in the pharmaceutical industry ...

Compound Q&A

What precautions should be taken when handling 2-Chloro-1H-indole-3-carbaldehyde (CAS: 5059-30-3)?

When handling 2-Chloro-1H-indole-3-carbaldehyde (CAS: 5059-30-3), it is important to use personal pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...