Compound Q&A

What industries use 2,2,3,3-Tetrafluoropropyl 4-methylbenzenesulfonate (CAS: 786-31-2)?

Answer

2,2,3,3-Tetrafluoropropyl 4-methylbenzenesulfonate
2,2,3,3-Tetrafluoropropyl 4-methylbenzenesulfonate is used in various industries, particularly in the pharmaceutical and polymer industries. It serves as a sulfonating agent in the synthesis of pharmaceuticals and acts as a functional group in the development of advanced polymers with specific properties. Additionally, it finds applications in the production of sensors and semiconductors where its chemical stability and reactivity are advantageous.

About

CAS No 786-31-2
English Name 2,2,3,3-Tetrafluoropropyl 4-methylbenzenesulfonate
Molecular Formula C10H10F4O3S
Molecular Weight 286.25 g/mol
SMILES CC1=CC=C(C=C1)S(=O)(=O)OCC(C(F)F)(F)F
InChIKey IMDNPHAMGJIKNV-UHFFFAOYSA-N
Last Updated: 2025-10-31 20:53

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,2,3,3-Tetrafluoropropyl 4-methylbenzenesulfonate (CAS: 786-31-2)?

2,2,3,3-Tetrafluoropropyl 4-methylbenzenesulfonate is a crystalline solid with a molecular weight of...

Compound Q&A

How is 2,2,3,3-Tetrafluoropropyl 4-methylbenzenesulfonate (CAS: 786-31-2) typically synthesized?

2,2,3,3-Tetrafluoropropyl 4-methylbenzenesulfonate is typically synthesized through the sulfonation ...

Compound Q&A

What precautions should be taken when handling 2,2,3,3-Tetrafluoropropyl 4-methylbenzenesulfonate (CAS: 786-31-2)?

When handling 2,2,3,3-Tetrafluoropropyl 4-methylbenzenesulfonate (CAS: 786-31-2), it is essential to...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...