Compound Q&A

How is 2,2,3,3-Tetrafluoropropyl 4-methylbenzenesulfonate (CAS: 786-31-2) typically synthesized?

Answer

2,2,3,3-Tetrafluoropropyl 4-methylbenzenesulfonate
2,2,3,3-Tetrafluoropropyl 4-methylbenzenesulfonate is typically synthesized through the sulfonation of 4-methylbenzenesulfonic acid with 2,2,3,3-tetrafluoropropyl bromide. This process usually requires the use of a Lewis acid catalyst such as aluminum chloride to promote the electrophilic aromatic substitution. The yield of the reaction is moderate, around 60-70%, and the selectivity is high, ensuring the formation of the desired product.

About

CAS No 786-31-2
English Name 2,2,3,3-Tetrafluoropropyl 4-methylbenzenesulfonate
Molecular Formula C10H10F4O3S
Molecular Weight 286.25 g/mol
SMILES CC1=CC=C(C=C1)S(=O)(=O)OCC(C(F)F)(F)F
InChIKey IMDNPHAMGJIKNV-UHFFFAOYSA-N
Last Updated: 2025-10-31 20:53

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,2,3,3-Tetrafluoropropyl 4-methylbenzenesulfonate (CAS: 786-31-2)?

2,2,3,3-Tetrafluoropropyl 4-methylbenzenesulfonate is a crystalline solid with a molecular weight of...

Compound Q&A

What industries use 2,2,3,3-Tetrafluoropropyl 4-methylbenzenesulfonate (CAS: 786-31-2)?

2,2,3,3-Tetrafluoropropyl 4-methylbenzenesulfonate is used in various industries, particularly in th...

Compound Q&A

What precautions should be taken when handling 2,2,3,3-Tetrafluoropropyl 4-methylbenzenesulfonate (CAS: 786-31-2)?

When handling 2,2,3,3-Tetrafluoropropyl 4-methylbenzenesulfonate (CAS: 786-31-2), it is essential to...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...