Compound Q&A

What are the physical and chemical properties of 2,2,3,3-Tetrafluoropropyl 4-methylbenzenesulfonate (CAS: 786-31-2)?

Answer

2,2,3,3-Tetrafluoropropyl 4-methylbenzenesulfonate
2,2,3,3-Tetrafluoropropyl 4-methylbenzenesulfonate is a crystalline solid with a molecular weight of approximately 338.13 g/mol. It has limited water solubility and is soluble in polar organic solvents such as dimethylformamide (DMF) and dimethylsulfoxide (DMSO). This compound exhibits low reactivity under normal conditions but can undergo substitution reactions under certain conditions, making it useful in organic synthesis. Its physical properties include a melting point of around 55-59°C.

About

CAS No 786-31-2
English Name 2,2,3,3-Tetrafluoropropyl 4-methylbenzenesulfonate
Molecular Formula C10H10F4O3S
Molecular Weight 286.25 g/mol
SMILES CC1=CC=C(C=C1)S(=O)(=O)OCC(C(F)F)(F)F
InChIKey IMDNPHAMGJIKNV-UHFFFAOYSA-N
Last Updated: 2025-10-31 20:53

Related Q&A

Compound Q&A

How is 2,2,3,3-Tetrafluoropropyl 4-methylbenzenesulfonate (CAS: 786-31-2) typically synthesized?

2,2,3,3-Tetrafluoropropyl 4-methylbenzenesulfonate is typically synthesized through the sulfonation ...

Compound Q&A

What industries use 2,2,3,3-Tetrafluoropropyl 4-methylbenzenesulfonate (CAS: 786-31-2)?

2,2,3,3-Tetrafluoropropyl 4-methylbenzenesulfonate is used in various industries, particularly in th...

Compound Q&A

What precautions should be taken when handling 2,2,3,3-Tetrafluoropropyl 4-methylbenzenesulfonate (CAS: 786-31-2)?

When handling 2,2,3,3-Tetrafluoropropyl 4-methylbenzenesulfonate (CAS: 786-31-2), it is essential to...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...