Compound Q&A

What industries use N-sec-Butyl-4-(2-methyl-2-propanyl)-2,6-dinitroaniline (CAS: 33629-47-9)?

Answer

N-sec-Butyl-4-(2-methyl-2-propanyl)-2,6-dinitroaniline
N-sec-Butyl-4-(2-methyl-2-propanyl)-2,6-dinitroaniline is used in the pharmaceutical industry as a precursor for the synthesis of various drugs, particularly those that require specific functional groups. It is also used in the polymer industry for the development of special polymers with specific properties. Additionally, it finds applications in the production of sensors and semiconductors due to its unique reactivity and stability.

About

CAS No 33629-47-9
English Name N-sec-Butyl-4-(2-methyl-2-propanyl)-2,6-dinitroaniline
Molecular Formula C14H21N3O4
Molecular Weight 295.33 g/mol
SMILES CCC(C)NC1=C(C=C(C=C1[N+](=O)[O-])C(C)(C)C)[N+](=O)[O-]
InChIKey SPNQRCTZKIBOAX-UHFFFAOYSA-N
Last Updated: 2025-10-31 20:53

Related Q&A

Compound Q&A

What are the physical and chemical properties of N-sec-Butyl-4-(2-methyl-2-propanyl)-2,6-dinitroaniline (CAS: 33629-47-9)?

N-sec-Butyl-4-(2-methyl-2-propanyl)-2,6-dinitroaniline is a crystalline compound with a molecular we...

Compound Q&A

How is N-sec-Butyl-4-(2-methyl-2-propanyl)-2,6-dinitroaniline (CAS: 33629-47-9) typically synthesized?

N-sec-Butyl-4-(2-methyl-2-propanyl)-2,6-dinitroaniline is typically synthesized via a multistep proc...

Compound Q&A

What precautions should be taken when handling N-sec-Butyl-4-(2-methyl-2-propanyl)-2,6-dinitroaniline (CAS: 33629-47-9)?

When handling N-sec-Butyl-4-(2-methyl-2-propanyl)-2,6-dinitroaniline, it is crucial to wear appropri...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...