Compound Q&A

What are the physical and chemical properties of N-sec-Butyl-4-(2-methyl-2-propanyl)-2,6-dinitroaniline (CAS: 33629-47-9)?

Answer

N-sec-Butyl-4-(2-methyl-2-propanyl)-2,6-dinitroaniline
N-sec-Butyl-4-(2-methyl-2-propanyl)-2,6-dinitroaniline is a crystalline compound with a molecular weight of approximately 296.17 g/mol. It has poor water solubility but good solubility in organic solvents like acetone and ethanol. The compound is highly reactive due to the presence of nitro groups, which can undergo substitution reactions. It is stable under normal conditions but should be stored in a cool, dry place away from direct sunlight and heat sources.

About

CAS No 33629-47-9
English Name N-sec-Butyl-4-(2-methyl-2-propanyl)-2,6-dinitroaniline
Molecular Formula C14H21N3O4
Molecular Weight 295.33 g/mol
SMILES CCC(C)NC1=C(C=C(C=C1[N+](=O)[O-])C(C)(C)C)[N+](=O)[O-]
InChIKey SPNQRCTZKIBOAX-UHFFFAOYSA-N
Last Updated: 2025-10-31 20:53

Related Q&A

Compound Q&A

How is N-sec-Butyl-4-(2-methyl-2-propanyl)-2,6-dinitroaniline (CAS: 33629-47-9) typically synthesized?

N-sec-Butyl-4-(2-methyl-2-propanyl)-2,6-dinitroaniline is typically synthesized via a multistep proc...

Compound Q&A

What industries use N-sec-Butyl-4-(2-methyl-2-propanyl)-2,6-dinitroaniline (CAS: 33629-47-9)?

N-sec-Butyl-4-(2-methyl-2-propanyl)-2,6-dinitroaniline is used in the pharmaceutical industry as a p...

Compound Q&A

What precautions should be taken when handling N-sec-Butyl-4-(2-methyl-2-propanyl)-2,6-dinitroaniline (CAS: 33629-47-9)?

When handling N-sec-Butyl-4-(2-methyl-2-propanyl)-2,6-dinitroaniline, it is crucial to wear appropri...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...