Compound Q&A

How is N-sec-Butyl-4-(2-methyl-2-propanyl)-2,6-dinitroaniline (CAS: 33629-47-9) typically synthesized?

Answer

N-sec-Butyl-4-(2-methyl-2-propanyl)-2,6-dinitroaniline
N-sec-Butyl-4-(2-methyl-2-propanyl)-2,6-dinitroaniline is typically synthesized via a multistep process involving alkylation and nitration reactions. The synthesis starts with the alkylation of an appropriate aniline, followed by nitration with a mixture of nitric acid and sulfuric acid. The reaction is carried out under reflux conditions, and the product is purified by recrystallization from an appropriate solvent. Common solvents used include acetone and ethanol.

About

CAS No 33629-47-9
English Name N-sec-Butyl-4-(2-methyl-2-propanyl)-2,6-dinitroaniline
Molecular Formula C14H21N3O4
Molecular Weight 295.33 g/mol
SMILES CCC(C)NC1=C(C=C(C=C1[N+](=O)[O-])C(C)(C)C)[N+](=O)[O-]
InChIKey SPNQRCTZKIBOAX-UHFFFAOYSA-N
Last Updated: 2025-10-31 20:53

Related Q&A

Compound Q&A

What are the physical and chemical properties of N-sec-Butyl-4-(2-methyl-2-propanyl)-2,6-dinitroaniline (CAS: 33629-47-9)?

N-sec-Butyl-4-(2-methyl-2-propanyl)-2,6-dinitroaniline is a crystalline compound with a molecular we...

Compound Q&A

What industries use N-sec-Butyl-4-(2-methyl-2-propanyl)-2,6-dinitroaniline (CAS: 33629-47-9)?

N-sec-Butyl-4-(2-methyl-2-propanyl)-2,6-dinitroaniline is used in the pharmaceutical industry as a p...

Compound Q&A

What precautions should be taken when handling N-sec-Butyl-4-(2-methyl-2-propanyl)-2,6-dinitroaniline (CAS: 33629-47-9)?

When handling N-sec-Butyl-4-(2-methyl-2-propanyl)-2,6-dinitroaniline, it is crucial to wear appropri...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...