Compound Q&A

What industries use 1,1-Diphenyl-2-(2,4,6-trinitrophenyl)hydrazine (CAS: 1707-75-1)?

Answer

1,1-Diphenyl-2-(2,4,6-trinitrophenyl)hydrazine
1,1-Diphenyl-2-(2,4,6-trinitrophenyl)hydrazine is primarily used in the research and development of new chemical compounds, particularly in the field of materials science for its unique electronic and optical properties. It is also employed in pharmaceutical research and as a precursor in the synthesis of other compounds. Its applications in semiconductors and sensors are limited due to its instability and toxicity.

About

CAS No 1707-75-1
English Name 1,1-Diphenyl-2-(2,4,6-trinitrophenyl)hydrazine
Molecular Formula C18H13N5O6
Molecular Weight 395.3 g/mol
SMILES C1=CC=C(C=C1)N(C2=CC=CC=C2)NC3=C(C=C(C=C3[N+](=O)[O-])[N+](=O)[O-])[N+](=O)[O-]
InChIKey WCBPJVKVIMMEQC-UHFFFAOYSA-N
Last Updated: 2025-10-31 20:53

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,1-Diphenyl-2-(2,4,6-trinitrophenyl)hydrazine (CAS: 1707-75-1)?

1,1-Diphenyl-2-(2,4,6-trinitrophenyl)hydrazine is a crystalline solid with a molecular weight of app...

Compound Q&A

How is 1,1-Diphenyl-2-(2,4,6-trinitrophenyl)hydrazine (CAS: 1707-75-1) typically synthesized?

1,1-Diphenyl-2-(2,4,6-trinitrophenyl)hydrazine is typically synthesized through a multistep process ...

Compound Q&A

What precautions should be taken when handling 1,1-Diphenyl-2-(2,4,6-trinitrophenyl)hydrazine (CAS: 1707-75-1)?

When handling 1,1-Diphenyl-2-(2,4,6-trinitrophenyl)hydrazine, it is essential to wear appropriate pe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...