Compound Q&A

What are the physical and chemical properties of 1,1-Diphenyl-2-(2,4,6-trinitrophenyl)hydrazine (CAS: 1707-75-1)?

Answer

1,1-Diphenyl-2-(2,4,6-trinitrophenyl)hydrazine
1,1-Diphenyl-2-(2,4,6-trinitrophenyl)hydrazine is a crystalline solid with a molecular weight of approximately 485.29 g/mol. It is poorly soluble in water but soluble in strong polar solvents like dimethylformamide (DMF). This compound is known for its high reactivity and instability, especially in the presence of reducing agents or heat. Its color is typically brown or dark red.

About

CAS No 1707-75-1
English Name 1,1-Diphenyl-2-(2,4,6-trinitrophenyl)hydrazine
Molecular Formula C18H13N5O6
Molecular Weight 395.3 g/mol
SMILES C1=CC=C(C=C1)N(C2=CC=CC=C2)NC3=C(C=C(C=C3[N+](=O)[O-])[N+](=O)[O-])[N+](=O)[O-]
InChIKey WCBPJVKVIMMEQC-UHFFFAOYSA-N
Last Updated: 2025-10-31 20:53

Related Q&A

Compound Q&A

How is 1,1-Diphenyl-2-(2,4,6-trinitrophenyl)hydrazine (CAS: 1707-75-1) typically synthesized?

1,1-Diphenyl-2-(2,4,6-trinitrophenyl)hydrazine is typically synthesized through a multistep process ...

Compound Q&A

What industries use 1,1-Diphenyl-2-(2,4,6-trinitrophenyl)hydrazine (CAS: 1707-75-1)?

1,1-Diphenyl-2-(2,4,6-trinitrophenyl)hydrazine is primarily used in the research and development of ...

Compound Q&A

What precautions should be taken when handling 1,1-Diphenyl-2-(2,4,6-trinitrophenyl)hydrazine (CAS: 1707-75-1)?

When handling 1,1-Diphenyl-2-(2,4,6-trinitrophenyl)hydrazine, it is essential to wear appropriate pe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...