Compound Q&A

How is 1,1-Diphenyl-2-(2,4,6-trinitrophenyl)hydrazine (CAS: 1707-75-1) typically synthesized?

Answer

1,1-Diphenyl-2-(2,4,6-trinitrophenyl)hydrazine
1,1-Diphenyl-2-(2,4,6-trinitrophenyl)hydrazine is typically synthesized through a multistep process involving the reduction of 2,4,6-trinitrophenylhydrazine with phenylhydrazine, followed by condensation reactions. The synthesis often requires careful control of reaction conditions to achieve high yields and selectivity, and it may involve the use of Lewis acids or other catalysts.

About

CAS No 1707-75-1
English Name 1,1-Diphenyl-2-(2,4,6-trinitrophenyl)hydrazine
Molecular Formula C18H13N5O6
Molecular Weight 395.3 g/mol
SMILES C1=CC=C(C=C1)N(C2=CC=CC=C2)NC3=C(C=C(C=C3[N+](=O)[O-])[N+](=O)[O-])[N+](=O)[O-]
InChIKey WCBPJVKVIMMEQC-UHFFFAOYSA-N
Last Updated: 2025-10-31 20:53

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,1-Diphenyl-2-(2,4,6-trinitrophenyl)hydrazine (CAS: 1707-75-1)?

1,1-Diphenyl-2-(2,4,6-trinitrophenyl)hydrazine is a crystalline solid with a molecular weight of app...

Compound Q&A

What industries use 1,1-Diphenyl-2-(2,4,6-trinitrophenyl)hydrazine (CAS: 1707-75-1)?

1,1-Diphenyl-2-(2,4,6-trinitrophenyl)hydrazine is primarily used in the research and development of ...

Compound Q&A

What precautions should be taken when handling 1,1-Diphenyl-2-(2,4,6-trinitrophenyl)hydrazine (CAS: 1707-75-1)?

When handling 1,1-Diphenyl-2-(2,4,6-trinitrophenyl)hydrazine, it is essential to wear appropriate pe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...