Compound Q&A

What industries use (2-Amino-5-bromophenyl)(2-chlorophenyl)methanone (CAS: 60773-49-1)?

Answer

(2-Amino-5-bromophenyl)(2-chlorophenyl)methanone
(2-Amino-5-bromophenyl)(2-chlorophenyl)methanone (CAS: 60773-49-1) is primarily used in the pharmaceutical industry for the synthesis of certain drugs. It is also explored for use in the semiconductor industry for its potential in organic electronics and sensors. Its chemical properties make it useful in polymer and sensor applications as well.

About

CAS No 60773-49-1
English Name (2-Amino-5-bromophenyl)(2-chlorophenyl)methanone
Molecular Formula C13H9BrClNO
Molecular Weight 310.58 g/mol
SMILES C1=CC=C(C(=C1)C(=O)C2=C(C=CC(=C2)Br)N)Cl
InChIKey GTLLBGFJGUJABH-UHFFFAOYSA-N
Last Updated: 2025-10-31 17:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2-Amino-5-bromophenyl)(2-chlorophenyl)methanone (CAS: 60773-49-1)?

(2-Amino-5-bromophenyl)(2-chlorophenyl)methanone (CAS: 60773-49-1) is a crystalline compound with a ...

Compound Q&A

How is (2-Amino-5-bromophenyl)(2-chlorophenyl)methanone (CAS: 60773-49-1) typically synthesized?

(2-Amino-5-bromophenyl)(2-chlorophenyl)methanone (CAS: 60773-49-1) can be synthesized through a mult...

Compound Q&A

What precautions should be taken when handling (2-Amino-5-bromophenyl)(2-chlorophenyl)methanone (CAS: 60773-49-1)?

When handling (2-Amino-5-bromophenyl)(2-chlorophenyl)methanone (CAS: 60773-49-1), safety goggles and...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...