Compound Q&A

What are the physical and chemical properties of (2-Amino-5-bromophenyl)(2-chlorophenyl)methanone (CAS: 60773-49-1)?

Answer

(2-Amino-5-bromophenyl)(2-chlorophenyl)methanone
(2-Amino-5-bromophenyl)(2-chlorophenyl)methanone (CAS: 60773-49-1) is a crystalline compound with a molecular weight of approximately 333.02 g/mol. It has low water solubility but is soluble in organic solvents like dichloromethane and acetone. The compound is known for its stability under normal conditions but can undergo photodegradation. It is moderately reactive towards nucleophiles and can be used in various chemical reactions.

About

CAS No 60773-49-1
English Name (2-Amino-5-bromophenyl)(2-chlorophenyl)methanone
Molecular Formula C13H9BrClNO
Molecular Weight 310.58 g/mol
SMILES C1=CC=C(C(=C1)C(=O)C2=C(C=CC(=C2)Br)N)Cl
InChIKey GTLLBGFJGUJABH-UHFFFAOYSA-N
Last Updated: 2025-10-31 17:33

Related Q&A

Compound Q&A

How is (2-Amino-5-bromophenyl)(2-chlorophenyl)methanone (CAS: 60773-49-1) typically synthesized?

(2-Amino-5-bromophenyl)(2-chlorophenyl)methanone (CAS: 60773-49-1) can be synthesized through a mult...

Compound Q&A

What industries use (2-Amino-5-bromophenyl)(2-chlorophenyl)methanone (CAS: 60773-49-1)?

(2-Amino-5-bromophenyl)(2-chlorophenyl)methanone (CAS: 60773-49-1) is primarily used in the pharmace...

Compound Q&A

What precautions should be taken when handling (2-Amino-5-bromophenyl)(2-chlorophenyl)methanone (CAS: 60773-49-1)?

When handling (2-Amino-5-bromophenyl)(2-chlorophenyl)methanone (CAS: 60773-49-1), safety goggles and...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...