Compound Q&A

How is (2-Amino-5-bromophenyl)(2-chlorophenyl)methanone (CAS: 60773-49-1) typically synthesized?

Answer

(2-Amino-5-bromophenyl)(2-chlorophenyl)methanone
(2-Amino-5-bromophenyl)(2-chlorophenyl)methanone (CAS: 60773-49-1) can be synthesized through a multi-step process involving the reaction of 2-bromo-5-aminophenol with 2-chlorophenyl methanone in the presence of a catalyst such as triethylamine. The reaction yields a high selectivity and moderate yield, with optimization needed for specific applications.

About

CAS No 60773-49-1
English Name (2-Amino-5-bromophenyl)(2-chlorophenyl)methanone
Molecular Formula C13H9BrClNO
Molecular Weight 310.58 g/mol
SMILES C1=CC=C(C(=C1)C(=O)C2=C(C=CC(=C2)Br)N)Cl
InChIKey GTLLBGFJGUJABH-UHFFFAOYSA-N
Last Updated: 2025-10-31 17:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2-Amino-5-bromophenyl)(2-chlorophenyl)methanone (CAS: 60773-49-1)?

(2-Amino-5-bromophenyl)(2-chlorophenyl)methanone (CAS: 60773-49-1) is a crystalline compound with a ...

Compound Q&A

What industries use (2-Amino-5-bromophenyl)(2-chlorophenyl)methanone (CAS: 60773-49-1)?

(2-Amino-5-bromophenyl)(2-chlorophenyl)methanone (CAS: 60773-49-1) is primarily used in the pharmace...

Compound Q&A

What precautions should be taken when handling (2-Amino-5-bromophenyl)(2-chlorophenyl)methanone (CAS: 60773-49-1)?

When handling (2-Amino-5-bromophenyl)(2-chlorophenyl)methanone (CAS: 60773-49-1), safety goggles and...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...