Compound Q&A

What industries use N-Azidoacetylglucosamine, Acetylated (CAS: 98924-81-3)?

Answer

N-Azidoacetylglucosamine, Acetylated
N-Azidoacetylglucosamine, Acetylated (CAS: 98924-81-3) is primarily used in pharmaceuticals for the modification of biomolecules. It is also applied in the production of sensors and semiconductors due to its reactivity and specific functional groups. Additionally, it is utilized in polymer chemistry for creating novel materials with unique properties.

About

CAS No 98924-81-3
English Name N-Azidoacetylglucosamine, Acetylated
Molecular Formula C16H22N4O10
Molecular Weight 430.37 g/mol
SMILES CC(=O)OCC1C(C(C(C(O1)OC(=O)C)NC(=O)CN=[N+]=[N-])OC(=O)C)OC(=O)C
InChIKey HGMISDAXLUIXKM-ALTVCHKUSA-N
Last Updated: 2025-10-31 17:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of N-Azidoacetylglucosamine, Acetylated (CAS: 98924-81-3)?

N-Azidoacetylglucosamine, Acetylated (CAS: 98924-81-3) is a crystalline compound with a molecular we...

Compound Q&A

How is N-Azidoacetylglucosamine, Acetylated (CAS: 98924-81-3) typically synthesized?

N-Azidoacetylglucosamine, Acetylated (CAS: 98924-81-3) is typically synthesized via acetylation of N...

Compound Q&A

What precautions should be taken when handling N-Azidoacetylglucosamine, Acetylated (CAS: 98924-81-3)?

When handling N-Azidoacetylglucosamine, Acetylated (CAS: 98924-81-3), proper personal protective equ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...