Compound Q&A

What are the physical and chemical properties of N-Azidoacetylglucosamine, Acetylated (CAS: 98924-81-3)?

Answer

N-Azidoacetylglucosamine, Acetylated
N-Azidoacetylglucosamine, Acetylated (CAS: 98924-81-3) is a crystalline compound with a molecular weight of approximately 273.33 g/mol. It is slightly soluble in water but soluble in organic solvents like ethanol and acetone. The compound is highly reactive, particularly with nucleophiles and reducing agents, making it suitable for various chemical modifications and labeling applications.

About

CAS No 98924-81-3
English Name N-Azidoacetylglucosamine, Acetylated
Molecular Formula C16H22N4O10
Molecular Weight 430.37 g/mol
SMILES CC(=O)OCC1C(C(C(C(O1)OC(=O)C)NC(=O)CN=[N+]=[N-])OC(=O)C)OC(=O)C
InChIKey HGMISDAXLUIXKM-ALTVCHKUSA-N
Last Updated: 2025-10-31 17:33

Related Q&A

Compound Q&A

How is N-Azidoacetylglucosamine, Acetylated (CAS: 98924-81-3) typically synthesized?

N-Azidoacetylglucosamine, Acetylated (CAS: 98924-81-3) is typically synthesized via acetylation of N...

Compound Q&A

What industries use N-Azidoacetylglucosamine, Acetylated (CAS: 98924-81-3)?

N-Azidoacetylglucosamine, Acetylated (CAS: 98924-81-3) is primarily used in pharmaceuticals for the ...

Compound Q&A

What precautions should be taken when handling N-Azidoacetylglucosamine, Acetylated (CAS: 98924-81-3)?

When handling N-Azidoacetylglucosamine, Acetylated (CAS: 98924-81-3), proper personal protective equ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...