Compound Q&A

How is N-Azidoacetylglucosamine, Acetylated (CAS: 98924-81-3) typically synthesized?

Answer

N-Azidoacetylglucosamine, Acetylated
N-Azidoacetylglucosamine, Acetylated (CAS: 98924-81-3) is typically synthesized via acetylation of N-azidoacetylmannosamine. The synthesis involves the use of acetic anhydride and a catalytic amount of an acid like hydrochloric acid. The reaction is carried out in an organic solvent under mild heating conditions, resulting in high yield and selectivity.

About

CAS No 98924-81-3
English Name N-Azidoacetylglucosamine, Acetylated
Molecular Formula C16H22N4O10
Molecular Weight 430.37 g/mol
SMILES CC(=O)OCC1C(C(C(C(O1)OC(=O)C)NC(=O)CN=[N+]=[N-])OC(=O)C)OC(=O)C
InChIKey HGMISDAXLUIXKM-ALTVCHKUSA-N
Last Updated: 2025-10-31 17:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of N-Azidoacetylglucosamine, Acetylated (CAS: 98924-81-3)?

N-Azidoacetylglucosamine, Acetylated (CAS: 98924-81-3) is a crystalline compound with a molecular we...

Compound Q&A

What industries use N-Azidoacetylglucosamine, Acetylated (CAS: 98924-81-3)?

N-Azidoacetylglucosamine, Acetylated (CAS: 98924-81-3) is primarily used in pharmaceuticals for the ...

Compound Q&A

What precautions should be taken when handling N-Azidoacetylglucosamine, Acetylated (CAS: 98924-81-3)?

When handling N-Azidoacetylglucosamine, Acetylated (CAS: 98924-81-3), proper personal protective equ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...