Compound Q&A

What industries use 2-Methyl-1,2-benzothiazol-3(2H)-one 1,1-dioxide (CAS: 15448-99-4)?

Answer

2-Methyl-1,2-benzothiazol-3(2H)-one 1,1-dioxide
2-Methyl-1,2-benzothiazol-3(2H)-one 1,1-dioxide is used in various industries, including pharmaceuticals, where it serves as a precursor for drug synthesis, and in the production of polymers and sensors. It is also utilized in the semiconductor industry for its electronic properties.

About

CAS No 15448-99-4
English Name 2-Methyl-1,2-benzothiazol-3(2H)-one 1,1-dioxide
Molecular Formula C8H7NO3S
Molecular Weight 197.21 g/mol
SMILES CN1C(=O)C2=CC=CC=C2S1(=O)=O
InChIKey DDIIAJRLFATEEE-UHFFFAOYSA-N
Last Updated: 2025-10-31 17:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-1,2-benzothiazol-3(2H)-one 1,1-dioxide (CAS: 15448-99-4)?

2-Methyl-1,2-benzothiazol-3(2H)-one 1,1-dioxide is a crystalline solid with a molecular weight of ap...

Compound Q&A

How is 2-Methyl-1,2-benzothiazol-3(2H)-one 1,1-dioxide (CAS: 15448-99-4) typically synthesized?

2-Methyl-1,2-benzothiazol-3(2H)-one 1,1-dioxide is usually synthesized via the condensation of 2-met...

Compound Q&A

What precautions should be taken when handling 2-Methyl-1,2-benzothiazol-3(2H)-one 1,1-dioxide (CAS: 15448-99-4)?

When handling 2-Methyl-1,2-benzothiazol-3(2H)-one 1,1-dioxide, it is essential to wear appropriate p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...