Compound Q&A

What are the physical and chemical properties of 2-Methyl-1,2-benzothiazol-3(2H)-one 1,1-dioxide (CAS: 15448-99-4)?

Answer

2-Methyl-1,2-benzothiazol-3(2H)-one 1,1-dioxide
2-Methyl-1,2-benzothiazol-3(2H)-one 1,1-dioxide is a crystalline solid with a molecular weight of approximately 236.24 g/mol. It has a high solubility in organic solvents such as methanol and ethanol, but is only slightly soluble in water. Chemically, it is relatively stable under normal conditions but can react with strong acids to form thioethers. It is also known for its reactivity towards nucleophiles, making it useful in various synthetic transformations.

About

CAS No 15448-99-4
English Name 2-Methyl-1,2-benzothiazol-3(2H)-one 1,1-dioxide
Molecular Formula C8H7NO3S
Molecular Weight 197.21 g/mol
SMILES CN1C(=O)C2=CC=CC=C2S1(=O)=O
InChIKey DDIIAJRLFATEEE-UHFFFAOYSA-N
Last Updated: 2025-10-31 17:33

Related Q&A

Compound Q&A

How is 2-Methyl-1,2-benzothiazol-3(2H)-one 1,1-dioxide (CAS: 15448-99-4) typically synthesized?

2-Methyl-1,2-benzothiazol-3(2H)-one 1,1-dioxide is usually synthesized via the condensation of 2-met...

Compound Q&A

What industries use 2-Methyl-1,2-benzothiazol-3(2H)-one 1,1-dioxide (CAS: 15448-99-4)?

2-Methyl-1,2-benzothiazol-3(2H)-one 1,1-dioxide is used in various industries, including pharmaceuti...

Compound Q&A

What precautions should be taken when handling 2-Methyl-1,2-benzothiazol-3(2H)-one 1,1-dioxide (CAS: 15448-99-4)?

When handling 2-Methyl-1,2-benzothiazol-3(2H)-one 1,1-dioxide, it is essential to wear appropriate p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...