Compound Q&A

How is 2-Methyl-1,2-benzothiazol-3(2H)-one 1,1-dioxide (CAS: 15448-99-4) typically synthesized?

Answer

2-Methyl-1,2-benzothiazol-3(2H)-one 1,1-dioxide
2-Methyl-1,2-benzothiazol-3(2H)-one 1,1-dioxide is usually synthesized via the condensation of 2-methylbenzothiazole and nitrous acid in the presence of a suitable catalyst. The reaction is typically performed under mild conditions, and the product can be isolated by recrystallization. The yield of the product is generally high, and the process is known for its good selectivity.

About

CAS No 15448-99-4
English Name 2-Methyl-1,2-benzothiazol-3(2H)-one 1,1-dioxide
Molecular Formula C8H7NO3S
Molecular Weight 197.21 g/mol
SMILES CN1C(=O)C2=CC=CC=C2S1(=O)=O
InChIKey DDIIAJRLFATEEE-UHFFFAOYSA-N
Last Updated: 2025-10-31 17:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-1,2-benzothiazol-3(2H)-one 1,1-dioxide (CAS: 15448-99-4)?

2-Methyl-1,2-benzothiazol-3(2H)-one 1,1-dioxide is a crystalline solid with a molecular weight of ap...

Compound Q&A

What industries use 2-Methyl-1,2-benzothiazol-3(2H)-one 1,1-dioxide (CAS: 15448-99-4)?

2-Methyl-1,2-benzothiazol-3(2H)-one 1,1-dioxide is used in various industries, including pharmaceuti...

Compound Q&A

What precautions should be taken when handling 2-Methyl-1,2-benzothiazol-3(2H)-one 1,1-dioxide (CAS: 15448-99-4)?

When handling 2-Methyl-1,2-benzothiazol-3(2H)-one 1,1-dioxide, it is essential to wear appropriate p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...