Compound Q&A

What industries use Dimethyl 4-fluorophthalate (CAS: 110706-50-8)?

Answer

Dimethyl 4-fluorophthalate
Dimethyl 4-fluorophthalate (CAS: 110706-50-8) is used in various industries, including pharmaceuticals, where it serves as a precursor in the synthesis of certain drugs. It is also used in the polymer industry as a plasticizer. Additionally, it finds applications in the production of sensors and semiconductors due to its unique chemical properties.

About

English Name Dimethyl 4-fluorophthalate
Molecular Formula C10H9FO4
Molecular Weight 212.18 g/mol
SMILES COC(=O)C1=C(C=C(C=C1)F)C(=O)OC
InChIKey UPXQAPWOMHKSBU-UHFFFAOYSA-N
Last Updated: 2025-10-31 17:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of Dimethyl 4-fluorophthalate (CAS: 110706-50-8)?

Dimethyl 4-fluorophthalate (CAS: 110706-50-8) is a colorless, clear liquid with a molecular weight o...

Compound Q&A

How is Dimethyl 4-fluorophthalate (CAS: 110706-50-8) typically synthesized?

Dimethyl 4-fluorophthalate (CAS: 110706-50-8) is typically synthesized by the reaction of 4-fluoroph...

Compound Q&A

What precautions should be taken when handling Dimethyl 4-fluorophthalate (CAS: 110706-50-8)?

When handling Dimethyl 4-fluorophthalate (CAS: 110706-50-8), it is important to wear appropriate per...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...