Compound Q&A

What are the physical and chemical properties of Dimethyl 4-fluorophthalate (CAS: 110706-50-8)?

Answer

Dimethyl 4-fluorophthalate
Dimethyl 4-fluorophthalate (CAS: 110706-50-8) is a colorless, clear liquid with a molecular weight of 216.16 g/mol. It has a melting point of -23°C and a boiling point of 215°C. This compound is soluble in water and a variety of organic solvents. It is moderately reactive and can form ester bonds under certain conditions. It is generally stable but should be stored away from strong acids and bases.

About

English Name Dimethyl 4-fluorophthalate
Molecular Formula C10H9FO4
Molecular Weight 212.18 g/mol
SMILES COC(=O)C1=C(C=C(C=C1)F)C(=O)OC
InChIKey UPXQAPWOMHKSBU-UHFFFAOYSA-N
Last Updated: 2025-10-31 17:33

Related Q&A

Compound Q&A

How is Dimethyl 4-fluorophthalate (CAS: 110706-50-8) typically synthesized?

Dimethyl 4-fluorophthalate (CAS: 110706-50-8) is typically synthesized by the reaction of 4-fluoroph...

Compound Q&A

What industries use Dimethyl 4-fluorophthalate (CAS: 110706-50-8)?

Dimethyl 4-fluorophthalate (CAS: 110706-50-8) is used in various industries, including pharmaceutica...

Compound Q&A

What precautions should be taken when handling Dimethyl 4-fluorophthalate (CAS: 110706-50-8)?

When handling Dimethyl 4-fluorophthalate (CAS: 110706-50-8), it is important to wear appropriate per...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...