Compound Q&A

How is Dimethyl 4-fluorophthalate (CAS: 110706-50-8) typically synthesized?

Answer

Dimethyl 4-fluorophthalate
Dimethyl 4-fluorophthalate (CAS: 110706-50-8) is typically synthesized by the reaction of 4-fluorophthalic anhydride with dimethyl alcohol in the presence of a suitable catalyst such as sulfuric acid or p-toluenesulfonic acid. The reaction is carried out under reflux conditions, and the product is purified by recrystallization or distillation to obtain a high-purity product with a yield of around 85-90%.

About

English Name Dimethyl 4-fluorophthalate
Molecular Formula C10H9FO4
Molecular Weight 212.18 g/mol
SMILES COC(=O)C1=C(C=C(C=C1)F)C(=O)OC
InChIKey UPXQAPWOMHKSBU-UHFFFAOYSA-N
Last Updated: 2025-10-31 17:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of Dimethyl 4-fluorophthalate (CAS: 110706-50-8)?

Dimethyl 4-fluorophthalate (CAS: 110706-50-8) is a colorless, clear liquid with a molecular weight o...

Compound Q&A

What industries use Dimethyl 4-fluorophthalate (CAS: 110706-50-8)?

Dimethyl 4-fluorophthalate (CAS: 110706-50-8) is used in various industries, including pharmaceutica...

Compound Q&A

What precautions should be taken when handling Dimethyl 4-fluorophthalate (CAS: 110706-50-8)?

When handling Dimethyl 4-fluorophthalate (CAS: 110706-50-8), it is important to wear appropriate per...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...